C17H28N2O3 — CID 17155997
N-tert-butyl-2-[2-methoxy-4-[(propan-2-ylamino)methyl]phenoxy]acetamide (PubChem CID 17155997) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is N-tert-butyl-2-[2-methoxy-4-[(propan-2-ylamino)methyl]phenoxy]acetamide.
| Compound Name | N-tert-butyl-2-[2-methoxy-4-[(propan-2-ylamino)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 17155997 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | N-tert-butyl-2-[2-methoxy-4-[(propan-2-ylamino)methyl]phenoxy]acetamide |
| SMILES | COc1cc(CNC(C)C)ccc1OCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H28N2O3/c1-12(2)18-10-13-7-8-14(15(9-13)21-6)22-11-16(20)19-17(3,4)5/h7-9,12,18H,10-11H2,1-6H3,(H,19,20) |
| InChIKey | PPWRZNFXGFXVBL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |