C13H18BrN3O4 — CID 63056501
2-[4-bromo-2-[(2-methoxyethylamino)methyl]phenoxy]-N-carbamoylacetamide (PubChem CID 63056501) has the molecular formula C13H18BrN3O4 and a molecular weight of 360.21 g/mol. Its IUPAC name is 2-[4-bromo-2-[(2-methoxyethylamino)methyl]phenoxy]-N-carbamoylacetamide.
| Compound Name | 2-[4-bromo-2-[(2-methoxyethylamino)methyl]phenoxy]-N-carbamoylacetamide |
|---|---|
| PubChem CID | 63056501 |
| Molecular Formula | C13H18BrN3O4 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 2-[4-bromo-2-[(2-methoxyethylamino)methyl]phenoxy]-N-carbamoylacetamide |
| SMILES | COCCNCc1cc(Br)ccc1OCC(=O)NC(N)=O |
| InChI | InChI=1S/C13H18BrN3O4/c1-20-5-4-16-7-9-6-10(14)2-3-11(9)21-8-12(18)17-13(15)19/h2-3,6,16H,4-5,7-8H2,1H3,(H3,15,17,18,19) |
| InChIKey | VCOGZYMPXHMCPR-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|