C14H22BrClN2O3 — CID 17053775
2-[4-bromo-2-[(3-ethoxypropylamino)methyl]phenoxy]acetamide;hydrochloride (PubChem CID 17053775) has the molecular formula C14H22BrClN2O3 and a molecular weight of 381.70 g/mol. Its IUPAC name is 2-[4-bromo-2-[(3-ethoxypropylamino)methyl]phenoxy]acetamide;hydrochloride.
| Compound Name | 2-[4-bromo-2-[(3-ethoxypropylamino)methyl]phenoxy]acetamide;hydrochloride |
|---|---|
| PubChem CID | 17053775 |
| Molecular Formula | C14H22BrClN2O3 |
| Molecular Weight | 381.70 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 2-[4-bromo-2-[(3-ethoxypropylamino)methyl]phenoxy]acetamide;hydrochloride |
| SMILES | CCOCCCNCc1cc(Br)ccc1OCC(N)=O.Cl |
| InChI | InChI=1S/C14H21BrN2O3.ClH/c1-2-19-7-3-6-17-9-11-8-12(15)4-5-13(11)20-10-14(16)18;/h4-5,8,17H,2-3,6-7,9-10H2,1H3,(H2,16,18);1H |
| InChIKey | YTTCLZKNWWQYIT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.70 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|