C15H24BrClN2O2 — CID 90484137
2-[4-bromo-2-[(4-methylpentylamino)methyl]phenoxy]acetamide;hydrochloride (PubChem CID 90484137) has the molecular formula C15H24BrClN2O2 and a molecular weight of 379.73 g/mol. Its IUPAC name is 2-[4-bromo-2-[(4-methylpentylamino)methyl]phenoxy]acetamide;hydrochloride.
| Compound Name | 2-[4-bromo-2-[(4-methylpentylamino)methyl]phenoxy]acetamide;hydrochloride |
|---|---|
| PubChem CID | 90484137 |
| Molecular Formula | C15H24BrClN2O2 |
| Molecular Weight | 379.73 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 2-[4-bromo-2-[(4-methylpentylamino)methyl]phenoxy]acetamide;hydrochloride |
| SMILES | CC(C)CCCNCc1cc(Br)ccc1OCC(N)=O.Cl |
| InChI | InChI=1S/C15H23BrN2O2.ClH/c1-11(2)4-3-7-18-9-12-8-13(16)5-6-14(12)20-10-15(17)19;/h5-6,8,11,18H,3-4,7,9-10H2,1-2H3,(H2,17,19);1H |
| InChIKey | WEZSQLVHWGUKGR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.73 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|