C19H25BrN2O4 — CID 66535022
2-[5-bromo-4-[(furan-2-ylmethylamino)methyl]-2-methoxyphenoxy]-N-tert-butylacetamide (PubChem CID 66535022) has the molecular formula C19H25BrN2O4 and a molecular weight of 425.32 g/mol. Its IUPAC name is 2-[5-bromo-4-[(furan-2-ylmethylamino)methyl]-2-methoxyphenoxy]-N-tert-butylacetamide.
| Compound Name | 2-[5-bromo-4-[(furan-2-ylmethylamino)methyl]-2-methoxyphenoxy]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 66535022 |
| Molecular Formula | C19H25BrN2O4 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 2-[5-bromo-4-[(furan-2-ylmethylamino)methyl]-2-methoxyphenoxy]-N-tert-butylacetamide |
| SMILES | COc1cc(CNCc2ccco2)c(Br)cc1OCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H25BrN2O4/c1-19(2,3)22-18(23)12-26-17-9-15(20)13(8-16(17)24-4)10-21-11-14-6-5-7-25-14/h5-9,21H,10-12H2,1-4H3,(H,22,23) |
| InChIKey | PYSGARYPQNDUCK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |