C21H34BrN3O4 — CID 66538130
2-[5-bromo-2-methoxy-4-[(3-morpholin-4-ylpropylamino)methyl]phenoxy]-N-tert-butylacetamide (PubChem CID 66538130) has the molecular formula C21H34BrN3O4 and a molecular weight of 472.42 g/mol. Its IUPAC name is 2-[5-bromo-2-methoxy-4-[(3-morpholin-4-ylpropylamino)methyl]phenoxy]-N-tert-butylacetamide.
| Compound Name | 2-[5-bromo-2-methoxy-4-[(3-morpholin-4-ylpropylamino)methyl]phenoxy]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 66538130 |
| Molecular Formula | C21H34BrN3O4 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 2-[5-bromo-2-methoxy-4-[(3-morpholin-4-ylpropylamino)methyl]phenoxy]-N-tert-butylacetamide |
| SMILES | COc1cc(CNCCCN2CCOCC2)c(Br)cc1OCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C21H34BrN3O4/c1-21(2,3)24-20(26)15-29-19-13-17(22)16(12-18(19)27-4)14-23-6-5-7-25-8-10-28-11-9-25/h12-13,23H,5-11,14-15H2,1-4H3,(H,24,26) |
| InChIKey | LOEOLUILMAOGJM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|