C20H35Cl2N3O4 — CID 17053452
N-tert-butyl-2-[2-methoxy-6-[(2-morpholin-4-ylethylamino)methyl]phenoxy]acetamide;dihydrochloride (PubChem CID 17053452) has the molecular formula C20H35Cl2N3O4 and a molecular weight of 452.42 g/mol. Its IUPAC name is N-tert-butyl-2-[2-methoxy-6-[(2-morpholin-4-ylethylamino)methyl]phenoxy]acetamide;dihydrochloride.
| Compound Name | N-tert-butyl-2-[2-methoxy-6-[(2-morpholin-4-ylethylamino)methyl]phenoxy]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 17053452 |
| Molecular Formula | C20H35Cl2N3O4 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | N-tert-butyl-2-[2-methoxy-6-[(2-morpholin-4-ylethylamino)methyl]phenoxy]acetamide;dihydrochloride |
| SMILES | COc1cccc(CNCCN2CCOCC2)c1OCC(=O)NC(C)(C)C.Cl.Cl |
| InChI | InChI=1S/C20H33N3O4.2ClH/c1-20(2,3)22-18(24)15-27-19-16(6-5-7-17(19)25-4)14-21-8-9-23-10-12-26-13-11-23;;/h5-7,21H,8-15H2,1-4H3,(H,22,24);2*1H |
| InChIKey | UXZGDUWZXWHDRQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|