C22H36N2O3 — CID 17053479
N-tert-butyl-2-[2-[(cyclooctylamino)methyl]-6-methoxyphenoxy]acetamide (PubChem CID 17053479) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is N-tert-butyl-2-[2-[(cyclooctylamino)methyl]-6-methoxyphenoxy]acetamide.
| Compound Name | N-tert-butyl-2-[2-[(cyclooctylamino)methyl]-6-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 17053479 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | N-tert-butyl-2-[2-[(cyclooctylamino)methyl]-6-methoxyphenoxy]acetamide |
| SMILES | COc1cccc(CNC2CCCCCCC2)c1OCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C22H36N2O3/c1-22(2,3)24-20(25)16-27-21-17(11-10-14-19(21)26-4)15-23-18-12-8-6-5-7-9-13-18/h10-11,14,18,23H,5-9,12-13,15-16H2,1-4H3,(H,24,25) |
| InChIKey | CCMAACYUNIETCC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |