C25H33BrClN3O3 — CID 66544641
2-[5-bromo-4-[(3-chloro-4-piperidin-1-ylanilino)methyl]-2-methoxyphenoxy]-N-tert-butylacetamide (PubChem CID 66544641) has the molecular formula C25H33BrClN3O3 and a molecular weight of 538.91 g/mol. Its IUPAC name is 2-[5-bromo-4-[(3-chloro-4-piperidin-1-ylanilino)methyl]-2-methoxyphenoxy]-N-tert-butylacetamide.
| Compound Name | 2-[5-bromo-4-[(3-chloro-4-piperidin-1-ylanilino)methyl]-2-methoxyphenoxy]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 66544641 |
| Molecular Formula | C25H33BrClN3O3 |
| Molecular Weight | 538.91 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | 2-[5-bromo-4-[(3-chloro-4-piperidin-1-ylanilino)methyl]-2-methoxyphenoxy]-N-tert-butylacetamide |
| SMILES | COc1cc(CNc2ccc(N3CCCCC3)c(Cl)c2)c(Br)cc1OCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C25H33BrClN3O3/c1-25(2,3)29-24(31)16-33-23-14-19(26)17(12-22(23)32-4)15-28-18-8-9-21(20(27)13-18)30-10-6-5-7-11-30/h8-9,12-14,28H,5-7,10-11,15-16H2,1-4H3,(H,29,31) |
| InChIKey | DCOADKCZINVNRE-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.91 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|