C26H36ClN3O3 — CID 66525660
N-tert-butyl-2-[4-[(3-chloro-4-piperidin-1-ylanilino)methyl]-2-ethoxyphenoxy]acetamide (PubChem CID 66525660) has the molecular formula C26H36ClN3O3 and a molecular weight of 474.05 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[(3-chloro-4-piperidin-1-ylanilino)methyl]-2-ethoxyphenoxy]acetamide.
| Compound Name | N-tert-butyl-2-[4-[(3-chloro-4-piperidin-1-ylanilino)methyl]-2-ethoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 66525660 |
| Molecular Formula | C26H36ClN3O3 |
| Molecular Weight | 474.05 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | N-tert-butyl-2-[4-[(3-chloro-4-piperidin-1-ylanilino)methyl]-2-ethoxyphenoxy]acetamide |
| SMILES | CCOc1cc(CNc2ccc(N3CCCCC3)c(Cl)c2)ccc1OCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C26H36ClN3O3/c1-5-32-24-15-19(9-12-23(24)33-18-25(31)29-26(2,3)4)17-28-20-10-11-22(21(27)16-20)30-13-7-6-8-14-30/h9-12,15-16,28H,5-8,13-14,17-18H2,1-4H3,(H,29,31) |
| InChIKey | YDLSPBBXVPASSK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.05 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|