C31H40N4O3 — CID 19644592
2-[4-[[4-(4-benzylpiperazin-1-yl)anilino]methyl]-2-methoxyphenoxy]-N-tert-butylacetamide (PubChem CID 19644592) has the molecular formula C31H40N4O3 and a molecular weight of 516.69 g/mol. Its IUPAC name is 2-[4-[[4-(4-benzylpiperazin-1-yl)anilino]methyl]-2-methoxyphenoxy]-N-tert-butylacetamide.
| Compound Name | 2-[4-[[4-(4-benzylpiperazin-1-yl)anilino]methyl]-2-methoxyphenoxy]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 19644592 |
| Molecular Formula | C31H40N4O3 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | 2-[4-[[4-(4-benzylpiperazin-1-yl)anilino]methyl]-2-methoxyphenoxy]-N-tert-butylacetamide |
| SMILES | COc1cc(CNc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)ccc1OCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C31H40N4O3/c1-31(2,3)33-30(36)23-38-28-15-10-25(20-29(28)37-4)21-32-26-11-13-27(14-12-26)35-18-16-34(17-19-35)22-24-8-6-5-7-9-24/h5-15,20,32H,16-19,21-23H2,1-4H3,(H,33,36) |
| InChIKey | BYSIGLGTXZIVDY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|