C23H30N2O5 — CID 66525561
ethyl 4-[[4-[2-(tert-butylamino)-2-oxoethoxy]-3-methoxyphenyl]methylamino]benzoate (PubChem CID 66525561) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is ethyl 4-[[4-[2-(tert-butylamino)-2-oxoethoxy]-3-methoxyphenyl]methylamino]benzoate.
| Compound Name | ethyl 4-[[4-[2-(tert-butylamino)-2-oxoethoxy]-3-methoxyphenyl]methylamino]benzoate |
|---|---|
| PubChem CID | 66525561 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | ethyl 4-[[4-[2-(tert-butylamino)-2-oxoethoxy]-3-methoxyphenyl]methylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NCc2ccc(OCC(=O)NC(C)(C)C)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H30N2O5/c1-6-29-22(27)17-8-10-18(11-9-17)24-14-16-7-12-19(20(13-16)28-5)30-15-21(26)25-23(2,3)4/h7-13,24H,6,14-15H2,1-5H3,(H,25,26) |
| InChIKey | SWDNEELGUJNTEX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |