C23H35N3O2 — CID 145113346
4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]-N-ethylaniline;ethane (PubChem CID 145113346) has the molecular formula C23H35N3O2 and a molecular weight of 385.55 g/mol. Its IUPAC name is 4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]-N-ethylaniline;ethane.
| Compound Name | 4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]-N-ethylaniline;ethane |
|---|---|
| PubChem CID | 145113346 |
| Molecular Formula | C23H35N3O2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | 4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]-N-ethylaniline;ethane |
| SMILES | CC.CCNc1ccc(N2CCN(Cc3ccc(OC)c(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C21H29N3O2.C2H6/c1-4-22-18-6-8-19(9-7-18)24-13-11-23(12-14-24)16-17-5-10-20(25-2)21(15-17)26-3;1-2/h5-10,15,22H,4,11-14,16H2,1-3H3;1-2H3 |
| InChIKey | NWHBZOXZMVAVRF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|