C20H26N2O2 — CID 59545760
1-(3,4-dimethoxyphenyl)-4-(4-ethylphenyl)piperazine (PubChem CID 59545760) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-4-(4-ethylphenyl)piperazine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-4-(4-ethylphenyl)piperazine |
|---|---|
| PubChem CID | 59545760 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-4-(4-ethylphenyl)piperazine |
| SMILES | CCc1ccc(N2CCN(c3ccc(OC)c(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C20H26N2O2/c1-4-16-5-7-17(8-6-16)21-11-13-22(14-12-21)18-9-10-19(23-2)20(15-18)24-3/h5-10,15H,4,11-14H2,1-3H3 |
| InChIKey | MMPWIVURKUMXBZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|