C19H22Cl2N2O3S — CID 2208743
1-(2,5-dichloro-4-methoxyphenyl)sulfonyl-4-(4-ethylphenyl)piperazine (PubChem CID 2208743) has the molecular formula C19H22Cl2N2O3S and a molecular weight of 429.37 g/mol. Its IUPAC name is 1-(2,5-dichloro-4-methoxyphenyl)sulfonyl-4-(4-ethylphenyl)piperazine.
| Compound Name | 1-(2,5-dichloro-4-methoxyphenyl)sulfonyl-4-(4-ethylphenyl)piperazine |
|---|---|
| PubChem CID | 2208743 |
| Molecular Formula | C19H22Cl2N2O3S |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 1-(2,5-dichloro-4-methoxyphenyl)sulfonyl-4-(4-ethylphenyl)piperazine |
| SMILES | CCc1ccc(N2CCN(S(=O)(=O)c3cc(Cl)c(OC)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C19H22Cl2N2O3S/c1-3-14-4-6-15(7-5-14)22-8-10-23(11-9-22)27(24,25)19-13-16(20)18(26-2)12-17(19)21/h4-7,12-13H,3,8-11H2,1-2H3 |
| InChIKey | DLLZEEQRYHEGIJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|