C19H23FN2O4S — CID 110363861
1-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methylsulfonyl]piperazine (PubChem CID 110363861) has the molecular formula C19H23FN2O4S and a molecular weight of 394.47 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methylsulfonyl]piperazine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methylsulfonyl]piperazine |
|---|---|
| PubChem CID | 110363861 |
| Molecular Formula | C19H23FN2O4S |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-4-[(4-fluorophenyl)methylsulfonyl]piperazine |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)Cc3ccc(F)cc3)CC2)cc1OC |
| InChI | InChI=1S/C19H23FN2O4S/c1-25-18-8-7-17(13-19(18)26-2)21-9-11-22(12-10-21)27(23,24)14-15-3-5-16(20)6-4-15/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | IDAAGVDRWKSXFY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|