C23H32N2O3 — CID 10134641
1-[1-(3,4-dimethoxyphenyl)propan-2-yl]-4-(4-methoxy-3-methylphenyl)piperazine (PubChem CID 10134641) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-[1-(3,4-dimethoxyphenyl)propan-2-yl]-4-(4-methoxy-3-methylphenyl)piperazine.
| Compound Name | 1-[1-(3,4-dimethoxyphenyl)propan-2-yl]-4-(4-methoxy-3-methylphenyl)piperazine |
|---|---|
| PubChem CID | 10134641 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 1-[1-(3,4-dimethoxyphenyl)propan-2-yl]-4-(4-methoxy-3-methylphenyl)piperazine |
| SMILES | COc1ccc(N2CCN(C(C)Cc3ccc(OC)c(OC)c3)CC2)cc1C |
| InChI | InChI=1S/C23H32N2O3/c1-17-14-20(7-9-21(17)26-3)25-12-10-24(11-13-25)18(2)15-19-6-8-22(27-4)23(16-19)28-5/h6-9,14,16,18H,10-13,15H2,1-5H3 |
| InChIKey | KUXXNUMYVMSYFZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|