C16H26N2O2 — CID 764481
1-[(3,4-dimethoxyphenyl)methyl]-4-propan-2-ylpiperazine (PubChem CID 764481) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-4-propan-2-ylpiperazine.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 764481 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-4-propan-2-ylpiperazine |
| SMILES | COc1ccc(CN2CCN(C(C)C)CC2)cc1OC |
| InChI | InChI=1S/C16H26N2O2/c1-13(2)18-9-7-17(8-10-18)12-14-5-6-15(19-3)16(11-14)20-4/h5-6,11,13H,7-10,12H2,1-4H3 |
| InChIKey | CASIZIKGYNFFOA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |