C17H28N2O2 — CID 174368866
1-butyl-4-[(3,4-dimethoxyphenyl)methyl]piperazine (PubChem CID 174368866) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1-butyl-4-[(3,4-dimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-butyl-4-[(3,4-dimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 174368866 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-butyl-4-[(3,4-dimethoxyphenyl)methyl]piperazine |
| SMILES | CCCCN1CCN(Cc2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C17H28N2O2/c1-4-5-8-18-9-11-19(12-10-18)14-15-6-7-16(20-2)17(13-15)21-3/h6-7,13H,4-5,8-12,14H2,1-3H3 |
| InChIKey | RWIFLZQQPJMAIZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |