C16H26N2O4S — CID 770674
1-[(3,4-dimethoxyphenyl)methyl]-4-propylsulfonylpiperazine (PubChem CID 770674) has the molecular formula C16H26N2O4S and a molecular weight of 342.46 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-4-propylsulfonylpiperazine.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-4-propylsulfonylpiperazine |
|---|---|
| PubChem CID | 770674 |
| Molecular Formula | C16H26N2O4S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-4-propylsulfonylpiperazine |
| SMILES | CCCS(=O)(=O)N1CCN(Cc2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C16H26N2O4S/c1-4-11-23(19,20)18-9-7-17(8-10-18)13-14-5-6-15(21-2)16(12-14)22-3/h5-6,12H,4,7-11,13H2,1-3H3 |
| InChIKey | HKBBXHSXCDEIFY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |