C18H30N2O4S — CID 113074549
1-butylsulfonyl-4-[2-(3,4-dimethoxyphenyl)ethyl]piperazine (PubChem CID 113074549) has the molecular formula C18H30N2O4S and a molecular weight of 370.52 g/mol. Its IUPAC name is 1-butylsulfonyl-4-[2-(3,4-dimethoxyphenyl)ethyl]piperazine.
| Compound Name | 1-butylsulfonyl-4-[2-(3,4-dimethoxyphenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 113074549 |
| Molecular Formula | C18H30N2O4S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 1-butylsulfonyl-4-[2-(3,4-dimethoxyphenyl)ethyl]piperazine |
| SMILES | CCCCS(=O)(=O)N1CCN(CCc2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C18H30N2O4S/c1-4-5-14-25(21,22)20-12-10-19(11-13-20)9-8-16-6-7-17(23-2)18(15-16)24-3/h6-7,15H,4-5,8-14H2,1-3H3 |
| InChIKey | PRAHWQCHQDRPGS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |