C15H25N2O4S+ — CID 4741964
1-[(3,4-dimethoxyphenyl)methyl]-4-ethylsulfonylpiperazin-1-ium (PubChem CID 4741964) has the molecular formula C15H25N2O4S+ and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-4-ethylsulfonylpiperazin-1-ium.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-4-ethylsulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 4741964 |
| Molecular Formula | C15H25N2O4S+ |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-4-ethylsulfonylpiperazin-1-ium |
| SMILES | CCS(=O)(=O)N1CC[NH+](Cc2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C15H24N2O4S/c1-4-22(18,19)17-9-7-16(8-10-17)12-13-5-6-14(20-2)15(11-13)21-3/h5-6,11H,4,7-10,12H2,1-3H3/p+1 |
| InChIKey | SFVKDYJVJJSMRI-UHFFFAOYSA-O |
| XLogP | -0.25 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |