C24H31N3O9S — CID 44665838
N-[4-[4-[(3-ethoxy-4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]sulfonylphenyl]acetamide;2-hydroxy-2-oxoacetate (PubChem CID 44665838) has the molecular formula C24H31N3O9S and a molecular weight of 537.59 g/mol. Its IUPAC name is N-[4-[4-[(3-ethoxy-4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]sulfonylphenyl]acetamide;2-hydroxy-2-oxoacetate.
| Compound Name | N-[4-[4-[(3-ethoxy-4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]sulfonylphenyl]acetamide;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 44665838 |
| Molecular Formula | C24H31N3O9S |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | N-[4-[4-[(3-ethoxy-4-methoxyphenyl)methyl]piperazin-4-ium-1-yl]sulfonylphenyl]acetamide;2-hydroxy-2-oxoacetate |
| SMILES | CCOc1cc(C[NH+]2CCN(S(=O)(=O)c3ccc(NC(C)=O)cc3)CC2)ccc1OC.O=C([O-])C(=O)O |
| InChI | InChI=1S/C22H29N3O5S.C2H2O4/c1-4-30-22-15-18(5-10-21(22)29-3)16-24-11-13-25(14-12-24)31(27,28)20-8-6-19(7-9-20)23-17(2)26;3-1(4)2(5)6/h5-10,15H,4,11-14,16H2,1-3H3,(H,23,26);(H,3,4)(H,5,6) |
| InChIKey | ZITSMZKOWNXPOA-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 166.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|