C22H32N2O6 — CID 44660875
1-(2-bicyclo[2.2.1]heptanyl)-4-[(3,4-dimethoxyphenyl)methyl]piperazin-4-ium;2-hydroxy-2-oxoacetate (PubChem CID 44660875) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-4-[(3,4-dimethoxyphenyl)methyl]piperazin-4-ium;2-hydroxy-2-oxoacetate.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-4-[(3,4-dimethoxyphenyl)methyl]piperazin-4-ium;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 44660875 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-4-[(3,4-dimethoxyphenyl)methyl]piperazin-4-ium;2-hydroxy-2-oxoacetate |
| SMILES | COc1ccc(C[NH+]2CCN(C3CC4CCC3C4)CC2)cc1OC.O=C([O-])C(=O)O |
| InChI | InChI=1S/C20H30N2O2.C2H2O4/c1-23-19-6-4-16(13-20(19)24-2)14-21-7-9-22(10-8-21)18-12-15-3-5-17(18)11-15;3-1(4)2(5)6/h4,6,13,15,17-18H,3,5,7-12,14H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | URQGZAGVIGNZIR-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|