C14H23N2O4S+ — CID 4752534
1-[(3,4-dimethoxyphenyl)methyl]-4-methylsulfonylpiperazin-1-ium (PubChem CID 4752534) has the molecular formula C14H23N2O4S+ and a molecular weight of 315.42 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-4-methylsulfonylpiperazin-1-ium.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-4-methylsulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 4752534 |
| Molecular Formula | C14H23N2O4S+ |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-4-methylsulfonylpiperazin-1-ium |
| SMILES | COc1ccc(C[NH+]2CCN(S(C)(=O)=O)CC2)cc1OC |
| InChI | InChI=1S/C14H22N2O4S/c1-19-13-5-4-12(10-14(13)20-2)11-15-6-8-16(9-7-15)21(3,17)18/h4-5,10H,6-9,11H2,1-3H3/p+1 |
| InChIKey | CMNMPWOQVUXPJD-UHFFFAOYSA-O |
| XLogP | -0.64 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |