C22H31N2O4S+ — CID 9188656
1-(3,4-diethoxyphenyl)sulfonyl-4-[(3-methylphenyl)methyl]piperazin-4-ium (PubChem CID 9188656) has the molecular formula C22H31N2O4S+ and a molecular weight of 419.57 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)sulfonyl-4-[(3-methylphenyl)methyl]piperazin-4-ium.
| Compound Name | 1-(3,4-diethoxyphenyl)sulfonyl-4-[(3-methylphenyl)methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 9188656 |
| Molecular Formula | C22H31N2O4S+ |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)sulfonyl-4-[(3-methylphenyl)methyl]piperazin-4-ium |
| SMILES | CCOc1ccc(S(=O)(=O)N2CC[NH+](Cc3cccc(C)c3)CC2)cc1OCC |
| InChI | InChI=1S/C22H30N2O4S/c1-4-27-21-10-9-20(16-22(21)28-5-2)29(25,26)24-13-11-23(12-14-24)17-19-8-6-7-18(3)15-19/h6-10,15-16H,4-5,11-14,17H2,1-3H3/p+1 |
| InChIKey | QSXXFBDPXLKBAE-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |