C19H32N2O2 — CID 68687798
3-butyl-1-[2-(3,4-dimethoxyphenyl)ethyl]piperidin-4-amine (PubChem CID 68687798) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 3-butyl-1-[2-(3,4-dimethoxyphenyl)ethyl]piperidin-4-amine.
| Compound Name | 3-butyl-1-[2-(3,4-dimethoxyphenyl)ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 68687798 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 3-butyl-1-[2-(3,4-dimethoxyphenyl)ethyl]piperidin-4-amine |
| SMILES | CCCCC1CN(CCc2ccc(OC)c(OC)c2)CCC1N |
| InChI | InChI=1S/C19H32N2O2/c1-4-5-6-16-14-21(12-10-17(16)20)11-9-15-7-8-18(22-2)19(13-15)23-3/h7-8,13,16-17H,4-6,9-12,14,20H2,1-3H3 |
| InChIKey | PCXDWFDNIPQQFB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |