C13H20N2O2 — CID 117010060
[1-[2-(3,4-dimethoxyphenyl)ethyl]aziridin-2-yl]methanamine (PubChem CID 117010060) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is [1-[2-(3,4-dimethoxyphenyl)ethyl]aziridin-2-yl]methanamine.
| Compound Name | [1-[2-(3,4-dimethoxyphenyl)ethyl]aziridin-2-yl]methanamine |
|---|---|
| PubChem CID | 117010060 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | [1-[2-(3,4-dimethoxyphenyl)ethyl]aziridin-2-yl]methanamine |
| SMILES | COc1ccc(CCN2CC2CN)cc1OC |
| InChI | InChI=1S/C13H20N2O2/c1-16-12-4-3-10(7-13(12)17-2)5-6-15-9-11(15)8-14/h3-4,7,11H,5-6,8-9,14H2,1-2H3 |
| InChIKey | KOKQIPDVQVCGEA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 47.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|