C14H21NO5S — CID 54171177
[1-[2-(3,4-dimethoxyphenyl)ethyl]azetidin-3-yl] methanesulfonate (PubChem CID 54171177) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is [1-[2-(3,4-dimethoxyphenyl)ethyl]azetidin-3-yl] methanesulfonate.
| Compound Name | [1-[2-(3,4-dimethoxyphenyl)ethyl]azetidin-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 54171177 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | [1-[2-(3,4-dimethoxyphenyl)ethyl]azetidin-3-yl] methanesulfonate |
| SMILES | COc1ccc(CCN2CC(OS(C)(=O)=O)C2)cc1OC |
| InChI | InChI=1S/C14H21NO5S/c1-18-13-5-4-11(8-14(13)19-2)6-7-15-9-12(10-15)20-21(3,16)17/h4-5,8,12H,6-7,9-10H2,1-3H3 |
| InChIKey | OVDHJRWQPBIKPO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|