C22H24N2O4 — CID 15045352
2-[1-[2-(3,4-dimethoxyphenyl)ethyl]pyrrolidin-3-yl]isoindole-1,3-dione (PubChem CID 15045352) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 2-[1-[2-(3,4-dimethoxyphenyl)ethyl]pyrrolidin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-[2-(3,4-dimethoxyphenyl)ethyl]pyrrolidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 15045352 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-[1-[2-(3,4-dimethoxyphenyl)ethyl]pyrrolidin-3-yl]isoindole-1,3-dione |
| SMILES | COc1ccc(CCN2CCC(N3C(=O)c4ccccc4C3=O)C2)cc1OC |
| InChI | InChI=1S/C22H24N2O4/c1-27-19-8-7-15(13-20(19)28-2)9-11-23-12-10-16(14-23)24-21(25)17-5-3-4-6-18(17)22(24)26/h3-8,13,16H,9-12,14H2,1-2H3 |
| InChIKey | VPNLBRGZJLEWIT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|