C19H29NO3 — CID 11898939
(4S,4aS,8aS)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-4-ol (PubChem CID 11898939) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is (4S,4aS,8aS)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-4-ol.
| Compound Name | (4S,4aS,8aS)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-4-ol |
|---|---|
| PubChem CID | 11898939 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (4S,4aS,8aS)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-4-ol |
| SMILES | COc1ccc(CCN2CC[C@H](O)[C@H]3CCCC[C@@H]32)cc1OC |
| InChI | InChI=1S/C19H29NO3/c1-22-18-8-7-14(13-19(18)23-2)9-11-20-12-10-17(21)15-5-3-4-6-16(15)20/h7-8,13,15-17,21H,3-6,9-12H2,1-2H3/t15-,16-,17-/m0/s1 |
| InChIKey | ZLUSDZFWNVWMLV-ULQDDVLXSA-N |
| XLogP | 2.87 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |