C13H21NO4S — CID 8891740
N-[(3,4-dimethoxyphenyl)methyl]butane-1-sulfonamide (PubChem CID 8891740) has the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]butane-1-sulfonamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 8891740 |
| Molecular Formula | C13H21NO4S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H21NO4S/c1-4-5-8-19(15,16)14-10-11-6-7-12(17-2)13(9-11)18-3/h6-7,9,14H,4-5,8,10H2,1-3H3 |
| InChIKey | FCWNEGKOSQZEKS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |