C11H15F2NO2S — CID 110781060
N-[(3,4-difluorophenyl)methyl]butane-1-sulfonamide (PubChem CID 110781060) has the molecular formula C11H15F2NO2S and a molecular weight of 263.31 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]butane-1-sulfonamide.
| Compound Name | N-[(3,4-difluorophenyl)methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 110781060 |
| Molecular Formula | C11H15F2NO2S |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H15F2NO2S/c1-2-3-6-17(15,16)14-8-9-4-5-10(12)11(13)7-9/h4-5,7,14H,2-3,6,8H2,1H3 |
| InChIKey | ZOEFTIRRXSHFPB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |