C13H20ClFN2O2S — CID 106055514
N-[(3-chloro-4-fluorophenyl)methyl]-3-(propylamino)propane-1-sulfonamide (PubChem CID 106055514) has the molecular formula C13H20ClFN2O2S and a molecular weight of 322.83 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-3-(propylamino)propane-1-sulfonamide.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-3-(propylamino)propane-1-sulfonamide |
|---|---|
| PubChem CID | 106055514 |
| Molecular Formula | C13H20ClFN2O2S |
| Molecular Weight | 322.83 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-3-(propylamino)propane-1-sulfonamide |
| SMILES | CCCNCCCS(=O)(=O)NCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H20ClFN2O2S/c1-2-6-16-7-3-8-20(18,19)17-10-11-4-5-13(15)12(14)9-11/h4-5,9,16-17H,2-3,6-8,10H2,1H3 |
| InChIKey | MCUFAUODGWKLIR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.83 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|