C14H22Cl2N2O2S — CID 106031101
N-[1-(2,4-dichlorophenyl)ethyl]-3-(propylamino)propane-1-sulfonamide (PubChem CID 106031101) has the molecular formula C14H22Cl2N2O2S and a molecular weight of 353.32 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-3-(propylamino)propane-1-sulfonamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-3-(propylamino)propane-1-sulfonamide |
|---|---|
| PubChem CID | 106031101 |
| Molecular Formula | C14H22Cl2N2O2S |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-3-(propylamino)propane-1-sulfonamide |
| SMILES | CCCNCCCS(=O)(=O)NC(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H22Cl2N2O2S/c1-3-7-17-8-4-9-21(19,20)18-11(2)13-6-5-12(15)10-14(13)16/h5-6,10-11,17-18H,3-4,7-9H2,1-2H3 |
| InChIKey | ADXABSAVTQMLIJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|