C11H15Cl2NO3S — CID 95762229
N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-methoxyethanesulfonamide (PubChem CID 95762229) has the molecular formula C11H15Cl2NO3S and a molecular weight of 312.22 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-methoxyethanesulfonamide.
| Compound Name | N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-methoxyethanesulfonamide |
|---|---|
| PubChem CID | 95762229 |
| Molecular Formula | C11H15Cl2NO3S |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-methoxyethanesulfonamide |
| SMILES | COCCS(=O)(=O)N[C@H](C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H15Cl2NO3S/c1-8(14-18(15,16)6-5-17-2)10-4-3-9(12)7-11(10)13/h3-4,7-8,14H,5-6H2,1-2H3/t8-/m1/s1 |
| InChIKey | DIIYKBLKVSSWNM-MRVPVSSYSA-N |
| XLogP | 2.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |