C16H15Cl2NO4S — CID 31761098
methyl 3-[[(1R)-1-(2,4-dichlorophenyl)ethyl]sulfamoyl]benzoate (PubChem CID 31761098) has the molecular formula C16H15Cl2NO4S and a molecular weight of 388.27 g/mol. Its IUPAC name is methyl 3-[[(1R)-1-(2,4-dichlorophenyl)ethyl]sulfamoyl]benzoate.
| Compound Name | methyl 3-[[(1R)-1-(2,4-dichlorophenyl)ethyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 31761098 |
| Molecular Formula | C16H15Cl2NO4S |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | methyl 3-[[(1R)-1-(2,4-dichlorophenyl)ethyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)N[C@H](C)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H15Cl2NO4S/c1-10(14-7-6-12(17)9-15(14)18)19-24(21,22)13-5-3-4-11(8-13)16(20)23-2/h3-10,19H,1-2H3/t10-/m1/s1 |
| InChIKey | DLBNWYSOCNIPID-SNVBAGLBSA-N |
| XLogP | 3.82 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |