methyl 3-[1-(2,4-dichlorophenyl)ethyl-methylcarbamoyl]benzoate

C18H17Cl2NO3 — CID 51117205

IUPACmethyl 3-[1-(2,4-dichlorophenyl)ethyl-methylcarbamoyl]benzoate
SMILESCOC(=O)c1cccc(C(=O)N(C)C(C)c2ccc(Cl)cc2Cl)c1
InChIInChI=1S/C18H17Cl2NO3/c1-11(15-8-7-14(19)10-16(15)20)21(2)17(22)12-5-4-6-13(9-12)18(23)24-3/h4-11H,1-3H3
InChIKeyRAVGQHSBORFPNP-UHFFFAOYSA-N
MW366.24 g/mol
LogP4.61
Rot. Bonds4

About methyl 3-[1-(2,4-dichlorophenyl)ethyl-methylcarbamoyl]benzoate

methyl 3-[1-(2,4-dichlorophenyl)ethyl-methylcarbamoyl]benzoate (PubChem CID 51117205) has the molecular formula C18H17Cl2NO3 and a molecular weight of 366.24 g/mol. Its IUPAC name is methyl 3-[1-(2,4-dichlorophenyl)ethyl-methylcarbamoyl]benzoate.

Molecular Properties

Compound Namemethyl 3-[1-(2,4-dichlorophenyl)ethyl-methylcarbamoyl]benzoate
PubChem CID51117205
Molecular FormulaC18H17Cl2NO3
Molecular Weight366.24 g/mol
Exact Mass365.06
IUPAC Namemethyl 3-[1-(2,4-dichlorophenyl)ethyl-methylcarbamoyl]benzoate
SMILESCOC(=O)c1cccc(C(=O)N(C)C(C)c2ccc(Cl)cc2Cl)c1
InChIInChI=1S/C18H17Cl2NO3/c1-11(15-8-7-14(19)10-16(15)20)21(2)17(22)12-5-4-6-13(9-12)18(23)24-3/h4-11H,1-3H3
InChIKeyRAVGQHSBORFPNP-UHFFFAOYSA-N
XLogP4.61
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500366.24
LogP ≤ 54.61
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-[1-(2,4-dichlorophenyl)ethyl-methylcarbamoyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[1-(2,4-dichlorophenyl)ethyl-methylcarbamoyl]benzoate?
The IUPAC name of methyl 3-[1-(2,4-dichlorophenyl)ethyl-methylcarbamoyl]benzoate (CID 51117205) is methyl 3-[1-(2,4-dichlorophenyl)ethyl-methylcarbamoyl]benzoate.
What is the SMILES notation for methyl 3-[1-(2,4-dichlorophenyl)ethyl-methylcarbamoyl]benzoate?
The canonical SMILES for methyl 3-[1-(2,4-dichlorophenyl)ethyl-methylcarbamoyl]benzoate is COC(=O)c1cccc(C(=O)N(C)C(C)c2ccc(Cl)cc2Cl)c1.
What is the InChIKey of methyl 3-[1-(2,4-dichlorophenyl)ethyl-methylcarbamoyl]benzoate?
The InChIKey is RAVGQHSBORFPNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2NO3/c1-11(15-8-7-14(19)10-16(15)20)21(2)17(22)12-5-4-6-13(9-12)18(23)24-3/h4-11H,1-3H3.
What are the key properties of methyl 3-[1-(2,4-dichlorophenyl)ethyl-methylcarbamoyl]benzoate?
methyl 3-[1-(2,4-dichlorophenyl)ethyl-methylcarbamoyl]benzoate has a molecular weight of 366.24 g/mol, XLogP of 4.61, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[1-(2,4-dichlorophenyl)ethyl-methylcarbamoyl]benzoate is sourced from PubChem (CID 51117205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).