C15H12Cl2N2O2S — CID 7510137
3-cyano-N-[(1R)-1-(2,4-dichlorophenyl)ethyl]benzenesulfonamide (PubChem CID 7510137) has the molecular formula C15H12Cl2N2O2S and a molecular weight of 355.25 g/mol. Its IUPAC name is 3-cyano-N-[(1R)-1-(2,4-dichlorophenyl)ethyl]benzenesulfonamide.
| Compound Name | 3-cyano-N-[(1R)-1-(2,4-dichlorophenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 7510137 |
| Molecular Formula | C15H12Cl2N2O2S |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 3-cyano-N-[(1R)-1-(2,4-dichlorophenyl)ethyl]benzenesulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)c1cccc(C#N)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2N2O2S/c1-10(14-6-5-12(16)8-15(14)17)19-22(20,21)13-4-2-3-11(7-13)9-18/h2-8,10,19H,1H3/t10-/m1/s1 |
| InChIKey | YJLXWQAOBFXYQC-SNVBAGLBSA-N |
| XLogP | 3.90 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |