C17H18Cl2N2O4S — CID 8797504
N-[5-[[(1S)-1-(2,4-dichlorophenyl)ethyl]sulfamoyl]-2-methoxyphenyl]acetamide (PubChem CID 8797504) has the molecular formula C17H18Cl2N2O4S and a molecular weight of 417.31 g/mol. Its IUPAC name is N-[5-[[(1S)-1-(2,4-dichlorophenyl)ethyl]sulfamoyl]-2-methoxyphenyl]acetamide.
| Compound Name | N-[5-[[(1S)-1-(2,4-dichlorophenyl)ethyl]sulfamoyl]-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 8797504 |
| Molecular Formula | C17H18Cl2N2O4S |
| Molecular Weight | 417.31 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | N-[5-[[(1S)-1-(2,4-dichlorophenyl)ethyl]sulfamoyl]-2-methoxyphenyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](C)c2ccc(Cl)cc2Cl)cc1NC(C)=O |
| InChI | InChI=1S/C17H18Cl2N2O4S/c1-10(14-6-4-12(18)8-15(14)19)21-26(23,24)13-5-7-17(25-3)16(9-13)20-11(2)22/h4-10,21H,1-3H3,(H,20,22)/t10-/m0/s1 |
| InChIKey | YQEWOEDVBATCPC-JTQLQIEISA-N |
| XLogP | 4.00 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |