C18H23NO5S — CID 110412902
N-[(3,4-dimethoxyphenyl)methyl]-2-(3-methoxyphenyl)ethanesulfonamide (PubChem CID 110412902) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-(3-methoxyphenyl)ethanesulfonamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(3-methoxyphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 110412902 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(3-methoxyphenyl)ethanesulfonamide |
| SMILES | COc1cccc(CCS(=O)(=O)NCc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C18H23NO5S/c1-22-16-6-4-5-14(11-16)9-10-25(20,21)19-13-15-7-8-17(23-2)18(12-15)24-3/h4-8,11-12,19H,9-10,13H2,1-3H3 |
| InChIKey | WEIFJGAZMVEKQP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |