C31H32N2O5S — CID 145113228
[4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]phenyl] 4-phenylbenzenesulfonate (PubChem CID 145113228) has the molecular formula C31H32N2O5S and a molecular weight of 544.67 g/mol. Its IUPAC name is [4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]phenyl] 4-phenylbenzenesulfonate.
| Compound Name | [4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]phenyl] 4-phenylbenzenesulfonate |
|---|---|
| PubChem CID | 145113228 |
| Molecular Formula | C31H32N2O5S |
| Molecular Weight | 544.67 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | [4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]phenyl] 4-phenylbenzenesulfonate |
| SMILES | COc1ccc(CN2CCN(c3ccc(OS(=O)(=O)c4ccc(-c5ccccc5)cc4)cc3)CC2)cc1OC |
| InChI | InChI=1S/C31H32N2O5S/c1-36-30-17-8-24(22-31(30)37-2)23-32-18-20-33(21-19-32)27-11-13-28(14-12-27)38-39(34,35)29-15-9-26(10-16-29)25-6-4-3-5-7-25/h3-17,22H,18-21,23H2,1-2H3 |
| InChIKey | YQUWGKLFGUVCPY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.67 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|