C26H27N3O4S2 — CID 145113225
[5-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]-2-methoxyphenyl] 4-methylbenzenesulfonate (PubChem CID 145113225) has the molecular formula C26H27N3O4S2 and a molecular weight of 509.65 g/mol. Its IUPAC name is [5-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]-2-methoxyphenyl] 4-methylbenzenesulfonate.
| Compound Name | [5-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]-2-methoxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 145113225 |
| Molecular Formula | C26H27N3O4S2 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | [5-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]-2-methoxyphenyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(CN2CCN(c3nsc4ccccc34)CC2)cc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H27N3O4S2/c1-19-7-10-21(11-8-19)35(30,31)33-24-17-20(9-12-23(24)32-2)18-28-13-15-29(16-14-28)26-22-5-3-4-6-25(22)34-27-26/h3-12,17H,13-16,18H2,1-2H3 |
| InChIKey | NEDFHCDJBKDYRD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|