C27H24N4O2S — CID 139959542
2-[[4-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 139959542) has the molecular formula C27H24N4O2S and a molecular weight of 468.58 g/mol. Its IUPAC name is 2-[[4-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139959542 |
| Molecular Formula | C27H24N4O2S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 2-[[4-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1ccc(CN2CCN(c3nsc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C27H24N4O2S/c32-26-21-5-1-2-6-22(21)27(33)31(26)18-20-11-9-19(10-12-20)17-29-13-15-30(16-14-29)25-23-7-3-4-8-24(23)34-28-25/h1-12H,13-18H2 |
| InChIKey | CLYBCVNXZRZUJX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|