About 3-pyrrolidin-1-yl-1,2-benzothiazole
3-pyrrolidin-1-yl-1,2-benzothiazole (PubChem CID 11074496) has the molecular formula C11H12N2S
and a molecular weight of 204.30 g/mol. Its IUPAC name is 3-pyrrolidin-1-yl-1,2-benzothiazole.
Molecular Properties
| Compound Name | 3-pyrrolidin-1-yl-1,2-benzothiazole |
| PubChem CID | 11074496 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 3-pyrrolidin-1-yl-1,2-benzothiazole |
| SMILES | c1ccc2c(N3CCCC3)nsc2c1 |
| InChI | InChI=1S/C11H12N2S/c1-2-6-10-9(5-1)11(12-14-10)13-7-3-4-8-13/h1-2,5-6H,3-4,7-8H2 |
| InChIKey | BGMOLTYPPZMUKV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-pyrrolidin-1-yl-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrolidin-1-yl-1,2-benzothiazole?
The IUPAC name of 3-pyrrolidin-1-yl-1,2-benzothiazole (CID 11074496) is 3-pyrrolidin-1-yl-1,2-benzothiazole.
What is the SMILES notation for 3-pyrrolidin-1-yl-1,2-benzothiazole?
The canonical SMILES for 3-pyrrolidin-1-yl-1,2-benzothiazole is c1ccc2c(N3CCCC3)nsc2c1.
What is the InChIKey of 3-pyrrolidin-1-yl-1,2-benzothiazole?
The InChIKey is BGMOLTYPPZMUKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2S/c1-2-6-10-9(5-1)11(12-14-10)13-7-3-4-8-13/h1-2,5-6H,3-4,7-8H2.
What are the key properties of 3-pyrrolidin-1-yl-1,2-benzothiazole?
3-pyrrolidin-1-yl-1,2-benzothiazole has a molecular weight of 204.30 g/mol, XLogP of 2.90, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrolidin-1-yl-1,2-benzothiazole is sourced from PubChem (CID 11074496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).