C11H17N3O5S2 — CID 24784011
3-piperazin-1-yl-1,2-benzothiazole;sulfuric acid;hydrate (PubChem CID 24784011) has the molecular formula C11H17N3O5S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 3-piperazin-1-yl-1,2-benzothiazole;sulfuric acid;hydrate.
| Compound Name | 3-piperazin-1-yl-1,2-benzothiazole;sulfuric acid;hydrate |
|---|---|
| PubChem CID | 24784011 |
| Molecular Formula | C11H17N3O5S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 3-piperazin-1-yl-1,2-benzothiazole;sulfuric acid;hydrate |
| SMILES | O.O=S(=O)(O)O.c1ccc2c(N3CCNCC3)nsc2c1 |
| InChI | InChI=1S/C11H13N3S.H2O4S.H2O/c1-2-4-10-9(3-1)11(13-15-10)14-7-5-12-6-8-14;1-5(2,3)4;/h1-4,12H,5-8H2;(H2,1,2,3,4);1H2 |
| InChIKey | QQURCKIHJXJUKR-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 134.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|