C11H14N3S+ — CID 7020932
3-piperazin-4-ium-1-yl-1,2-benzothiazole (PubChem CID 7020932) has the molecular formula C11H14N3S+ and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-piperazin-4-ium-1-yl-1,2-benzothiazole.
| Compound Name | 3-piperazin-4-ium-1-yl-1,2-benzothiazole |
|---|---|
| PubChem CID | 7020932 |
| Molecular Formula | C11H14N3S+ |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 3-piperazin-4-ium-1-yl-1,2-benzothiazole |
| SMILES | c1ccc2c(N3CC[NH2+]CC3)nsc2c1 |
| InChI | InChI=1S/C11H13N3S/c1-2-4-10-9(3-1)11(13-15-10)14-7-5-12-6-8-14/h1-4,12H,5-8H2/p+1 |
| InChIKey | KRDOFMHJLWKXIU-UHFFFAOYSA-O |
| XLogP | 0.68 |
| TPSA | 32.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |