C11H14ClN3S — CID 71643811
(3R)-1-(1,2-benzothiazol-3-yl)pyrrolidin-3-amine;hydrochloride (PubChem CID 71643811) has the molecular formula C11H14ClN3S and a molecular weight of 255.77 g/mol. Its IUPAC name is (3R)-1-(1,2-benzothiazol-3-yl)pyrrolidin-3-amine;hydrochloride.
| Compound Name | (3R)-1-(1,2-benzothiazol-3-yl)pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 71643811 |
| Molecular Formula | C11H14ClN3S |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | (3R)-1-(1,2-benzothiazol-3-yl)pyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1CCN(c2nsc3ccccc23)C1 |
| InChI | InChI=1S/C11H13N3S.ClH/c12-8-5-6-14(7-8)11-9-3-1-2-4-10(9)15-13-11;/h1-4,8H,5-7,12H2;1H/t8-;/m1./s1 |
| InChIKey | KUIQPJXTTLHEPV-DDWIOCJRSA-N |
| XLogP | 2.26 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |