C12H15N3S — CID 97165642
[(3S)-1-(1,2-benzothiazol-3-yl)pyrrolidin-3-yl]methanamine (PubChem CID 97165642) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is [(3S)-1-(1,2-benzothiazol-3-yl)pyrrolidin-3-yl]methanamine.
| Compound Name | [(3S)-1-(1,2-benzothiazol-3-yl)pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 97165642 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | [(3S)-1-(1,2-benzothiazol-3-yl)pyrrolidin-3-yl]methanamine |
| SMILES | NC[C@@H]1CCN(c2nsc3ccccc23)C1 |
| InChI | InChI=1S/C12H15N3S/c13-7-9-5-6-15(8-9)12-10-3-1-2-4-11(10)16-14-12/h1-4,9H,5-8,13H2/t9-/m0/s1 |
| InChIKey | YYIGVOVKISNRGA-VIFPVBQESA-N |
| XLogP | 2.08 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |