C19H18N4S — CID 166600533
3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]benzonitrile (PubChem CID 166600533) has the molecular formula C19H18N4S and a molecular weight of 334.45 g/mol. Its IUPAC name is 3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 166600533 |
| Molecular Formula | C19H18N4S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2CCN(c3nsc4ccccc34)CC2)c1 |
| InChI | InChI=1S/C19H18N4S/c20-13-15-4-3-5-16(12-15)14-22-8-10-23(11-9-22)19-17-6-1-2-7-18(17)24-21-19/h1-7,12H,8-11,14H2 |
| InChIKey | NVGBOYCLWDFYEM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |